C16H22O2 — CID 170693866
3-hydroxy-2,2,4,4-tetrakis(prop-2-enyl)cyclobutan-1-one (PubChem CID 170693866) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-hydroxy-2,2,4,4-tetrakis(prop-2-enyl)cyclobutan-1-one.
| Compound Name | 3-hydroxy-2,2,4,4-tetrakis(prop-2-enyl)cyclobutan-1-one |
|---|---|
| PubChem CID | 170693866 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 3-hydroxy-2,2,4,4-tetrakis(prop-2-enyl)cyclobutan-1-one |
| SMILES | C=CCC1(CC=C)C(=O)C(CC=C)(CC=C)C1O |
| InChI | InChI=1S/C16H22O2/c1-5-9-15(10-6-2)13(17)16(11-7-3,12-8-4)14(15)18/h5-8,13,17H,1-4,9-12H2 |
| InChIKey | XHLSLUMCJLWPIQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|