C13H18O — CID 164833479
(1R,4S)-3,3-bis(prop-2-enyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 164833479) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (1R,4S)-3,3-bis(prop-2-enyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4S)-3,3-bis(prop-2-enyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 164833479 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (1R,4S)-3,3-bis(prop-2-enyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | C=CCC1(CC=C)C(=O)[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C13H18O/c1-3-7-13(8-4-2)11-6-5-10(9-11)12(13)14/h3-4,10-11H,1-2,5-9H2/t10-,11+/m1/s1 |
| InChIKey | BMYIEDNKMGPSIB-MNOVXSKESA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|