About (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one
(1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one (PubChem CID 130826859) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one.
Molecular Properties
| Compound Name | (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one |
| PubChem CID | 130826859 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one |
| SMILES | O=C1[C@H]2CC[C@H](C2)C12CCCC2 |
| InChI | InChI=1S/C11H16O/c12-10-8-3-4-9(7-8)11(10)5-1-2-6-11/h8-9H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | ZYECBPXIFZTZEJ-DTWKUNHWSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one?
The IUPAC name of (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one (CID 130826859) is (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one.
What is the SMILES notation for (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one?
The canonical SMILES for (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one is O=C1[C@H]2CC[C@H](C2)C12CCCC2.
What is the InChIKey of (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one?
The InChIKey is ZYECBPXIFZTZEJ-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H16O/c12-10-8-3-4-9(7-8)11(10)5-1-2-6-11/h8-9H,1-7H2/t8-,9+/m0/s1.
What are the key properties of (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one?
(1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one has a molecular weight of 164.25 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-spiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-one is sourced from PubChem (CID 130826859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).