About ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate
ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate (PubChem CID 164833339) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate.
Molecular Properties
| Compound Name | ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate |
| PubChem CID | 164833339 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate |
| SMILES | CCOC(=O)C1=CCCC2(C1)C(=O)[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C15H20O3/c1-2-18-14(17)11-4-3-7-15(9-11)12-6-5-10(8-12)13(15)16/h4,10,12H,2-3,5-9H2,1H3/t10-,12+,15?/m1/s1 |
| InChIKey | DLKNUMGJIGXPHN-QEQOOXKLSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate?
The IUPAC name of ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate (CID 164833339) is ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate.
What is the SMILES notation for ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate?
The canonical SMILES for ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate is CCOC(=O)C1=CCCC2(C1)C(=O)[C@@H]1CC[C@H]2C1.
What is the InChIKey of ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate?
The InChIKey is DLKNUMGJIGXPHN-QEQOOXKLSA-N. The full InChI is InChI=1S/C15H20O3/c1-2-18-14(17)11-4-3-7-15(9-11)12-6-5-10(8-12)13(15)16/h4,10,12H,2-3,5-9H2,1H3/t10-,12+,15?/m1/s1.
What are the key properties of ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate?
ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate has a molecular weight of 248.32 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1S,4R)-3-oxospiro[bicyclo[2.2.1]heptane-2,5'-cyclohexene]-1'-carboxylate is sourced from PubChem (CID 164833339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).