C10H16O5S — CID 89347649
ethyl (5S)-5-methylsulfonyloxycyclohexene-1-carboxylate (PubChem CID 89347649) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is ethyl (5S)-5-methylsulfonyloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (5S)-5-methylsulfonyloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 89347649 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | ethyl (5S)-5-methylsulfonyloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H16O5S/c1-3-14-10(11)8-5-4-6-9(7-8)15-16(2,12)13/h5,9H,3-4,6-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | UNLWFYUHHLKFQG-VIFPVBQESA-N |
| XLogP | 1.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|