C14H24NO8PS — CID 74955390
ethyl 7-diethoxyphosphoryl-5-methylsulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 74955390) has the molecular formula C14H24NO8PS and a molecular weight of 397.39 g/mol. Its IUPAC name is ethyl 7-diethoxyphosphoryl-5-methylsulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | ethyl 7-diethoxyphosphoryl-5-methylsulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 74955390 |
| Molecular Formula | C14H24NO8PS |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | ethyl 7-diethoxyphosphoryl-5-methylsulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=CC2C(C(OS(C)(=O)=O)C1)N2P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H24NO8PS/c1-5-20-14(16)10-8-11-13(12(9-10)23-25(4,18)19)15(11)24(17,21-6-2)22-7-3/h8,11-13H,5-7,9H2,1-4H3 |
| InChIKey | QSJWPPNWXPKFCB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|