C23H27NO8S2 — CID 24888969
ethyl (3S,4R,5R)-4-amino-3,5-bis-(4-methylphenyl)sulfonyloxycyclohexene-1-carboxylate (PubChem CID 24888969) has the molecular formula C23H27NO8S2 and a molecular weight of 509.60 g/mol. Its IUPAC name is ethyl (3S,4R,5R)-4-amino-3,5-bis-(4-methylphenyl)sulfonyloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3S,4R,5R)-4-amino-3,5-bis-(4-methylphenyl)sulfonyloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 24888969 |
| Molecular Formula | C23H27NO8S2 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | ethyl (3S,4R,5R)-4-amino-3,5-bis-(4-methylphenyl)sulfonyloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@H](N)[C@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C23H27NO8S2/c1-4-30-23(25)17-13-20(31-33(26,27)18-9-5-15(2)6-10-18)22(24)21(14-17)32-34(28,29)19-11-7-16(3)8-12-19/h5-13,20-22H,4,14,24H2,1-3H3/t20-,21+,22-/m0/s1 |
| InChIKey | BRULRLOKOXJHQJ-BDTNDASRSA-N |
| XLogP | 2.37 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|