C33H39NO10S2 — CID 157363483
ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate;ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 157363483) has the molecular formula C33H39NO10S2 and a molecular weight of 673.81 g/mol. Its IUPAC name is ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate;ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate;ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 157363483 |
| Molecular Formula | C33H39NO10S2 |
| Molecular Weight | 673.81 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate;ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2C[C@@H]2[C@H](OS(=O)(=O)c2ccc(C)cc2)C1.CCOC(=O)C1=C[C@@H]2N[C@@H]2[C@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H20O5S.C16H19NO5S/c1-3-21-17(18)13-8-12-9-15(12)16(10-13)22-23(19,20)14-6-4-11(2)5-7-14;1-3-21-16(18)11-8-13-15(17-13)14(9-11)22-23(19,20)12-6-4-10(2)5-7-12/h4-8,12,15-16H,3,9-10H2,1-2H3;4-8,13-15,17H,3,9H2,1-2H3/t12-,15+,16-;13-,14+,15-/m10/s1 |
| InChIKey | BIXGFJJRLPWAOF-KVWYEGHUSA-N |
| XLogP | 3.90 |
| TPSA | 161.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|