C17H20O5S — CID 59650090
ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 59650090) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 59650090 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | ethyl (1S,5R,6S)-5-(4-methylphenyl)sulfonyloxybicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2C[C@@H]2[C@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H20O5S/c1-3-21-17(18)13-8-12-9-15(12)16(10-13)22-23(19,20)14-6-4-11(2)5-7-14/h4-8,12,15-16H,3,9-10H2,1-2H3/t12-,15+,16-/m1/s1 |
| InChIKey | ZPFBMXFQEFTCOO-UHOFOFEASA-N |
| XLogP | 2.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|