C16H18N4O6S — CID 122188221
ethyl 1-[[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]methyl]triazole-4-carboxylate (PubChem CID 122188221) has the molecular formula C16H18N4O6S and a molecular weight of 394.41 g/mol. Its IUPAC name is ethyl 1-[[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]methyl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 122188221 |
| Molecular Formula | C16H18N4O6S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 1-[[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC2CC(=O)N2OS(=O)(=O)c2ccc(C)cc2)nn1 |
| InChI | InChI=1S/C16H18N4O6S/c1-3-25-16(22)14-10-19(18-17-14)9-12-8-15(21)20(12)26-27(23,24)13-6-4-11(2)5-7-13/h4-7,10,12H,3,8-9H2,1-2H3 |
| InChIKey | XMXUCTWTJWFQJB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |