C30H39N9O6 — CID 102226572
ethyl 1-[[3,5-bis[(4-ethoxycarbonyltriazol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]triazole-4-carboxylate (PubChem CID 102226572) has the molecular formula C30H39N9O6 and a molecular weight of 621.70 g/mol. Its IUPAC name is ethyl 1-[[3,5-bis[(4-ethoxycarbonyltriazol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[[3,5-bis[(4-ethoxycarbonyltriazol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 102226572 |
| Molecular Formula | C30H39N9O6 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | ethyl 1-[[3,5-bis[(4-ethoxycarbonyltriazol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2c(CC)c(Cn3cc(C(=O)OCC)nn3)c(CC)c(Cn3cc(C(=O)OCC)nn3)c2CC)nn1 |
| InChI | InChI=1S/C30H39N9O6/c1-7-19-22(13-37-16-25(31-34-37)28(40)43-10-4)20(8-2)24(15-39-18-27(33-36-39)30(42)45-12-6)21(9-3)23(19)14-38-17-26(32-35-38)29(41)44-11-5/h16-18H,7-15H2,1-6H3 |
| InChIKey | PBESHFRYANOXHP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 171.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|