C7H11N3O5S — CID 139211404
ethyl 1-(2-sulfinooxyethyl)triazole-4-carboxylate (PubChem CID 139211404) has the molecular formula C7H11N3O5S and a molecular weight of 249.25 g/mol. Its IUPAC name is ethyl 1-(2-sulfinooxyethyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-(2-sulfinooxyethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 139211404 |
| Molecular Formula | C7H11N3O5S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | ethyl 1-(2-sulfinooxyethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCOS(=O)O)nn1 |
| InChI | InChI=1S/C7H11N3O5S/c1-2-14-7(11)6-5-10(9-8-6)3-4-15-16(12)13/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | LBWBTDKUFZDQBG-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|