C11H20N4O2 — CID 66226673
3,3-dimethylbutyl 1-(2-aminoethyl)triazole-4-carboxylate (PubChem CID 66226673) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3,3-dimethylbutyl 1-(2-aminoethyl)triazole-4-carboxylate.
| Compound Name | 3,3-dimethylbutyl 1-(2-aminoethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 66226673 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3,3-dimethylbutyl 1-(2-aminoethyl)triazole-4-carboxylate |
| SMILES | CC(C)(C)CCOC(=O)c1cn(CCN)nn1 |
| InChI | InChI=1S/C11H20N4O2/c1-11(2,3)4-7-17-10(16)9-8-15(6-5-12)14-13-9/h8H,4-7,12H2,1-3H3 |
| InChIKey | ZAPVFXLTNLNVQD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |