C13H25BrClN5O4 — CID 159208170
tert-butyl N-(2-bromoethyl)carbamate;methyl 1-(2-aminoethyl)triazole-4-carboxylate;hydrochloride (PubChem CID 159208170) has the molecular formula C13H25BrClN5O4 and a molecular weight of 430.73 g/mol. Its IUPAC name is tert-butyl N-(2-bromoethyl)carbamate;methyl 1-(2-aminoethyl)triazole-4-carboxylate;hydrochloride.
| Compound Name | tert-butyl N-(2-bromoethyl)carbamate;methyl 1-(2-aminoethyl)triazole-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 159208170 |
| Molecular Formula | C13H25BrClN5O4 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | tert-butyl N-(2-bromoethyl)carbamate;methyl 1-(2-aminoethyl)triazole-4-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NCCBr.COC(=O)c1cn(CCN)nn1.Cl |
| InChI | InChI=1S/C7H14BrNO2.C6H10N4O2.ClH/c1-7(2,3)11-6(10)9-5-4-8;1-12-6(11)5-4-10(3-2-7)9-8-5;/h4-5H2,1-3H3,(H,9,10);4H,2-3,7H2,1H3;1H |
| InChIKey | KQDMFGITCXDCKJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|