About methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate
methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate (PubChem CID 103107644) has the molecular formula C10H12BrN5O2
and a molecular weight of 314.14 g/mol. Its IUPAC name is methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate |
| PubChem CID | 103107644 |
| Molecular Formula | C10H12BrN5O2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(Cc2c(Br)c(C)nn2C)nn1 |
| InChI | InChI=1S/C10H12BrN5O2/c1-6-9(11)8(15(2)13-6)5-16-4-7(12-14-16)10(17)18-3/h4H,5H2,1-3H3 |
| InChIKey | DMYUADYGWUJXLF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate (CID 103107644) is methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate is COC(=O)c1cn(Cc2c(Br)c(C)nn2C)nn1.
What is the InChIKey of methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate?
The InChIKey is DMYUADYGWUJXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN5O2/c1-6-9(11)8(15(2)13-6)5-16-4-7(12-14-16)10(17)18-3/h4H,5H2,1-3H3.
What are the key properties of methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate?
methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate has a molecular weight of 314.14 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazole-4-carboxylate is sourced from PubChem (CID 103107644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).