C11H14BrN5O2 — CID 103107863
methyl 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]triazole-4-carboxylate (PubChem CID 103107863) has the molecular formula C11H14BrN5O2 and a molecular weight of 328.17 g/mol. Its IUPAC name is methyl 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103107863 |
| Molecular Formula | C11H14BrN5O2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | methyl 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]triazole-4-carboxylate |
| SMILES | CCc1nn(C)c(Cn2cc(C(=O)OC)nn2)c1Br |
| InChI | InChI=1S/C11H14BrN5O2/c1-4-7-10(12)9(16(2)14-7)6-17-5-8(13-15-17)11(18)19-3/h5H,4,6H2,1-3H3 |
| InChIKey | PCBKLMQZVFKMKR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |