C12H17N5O2 — CID 103108014
methyl 1-[(1-butan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate (PubChem CID 103108014) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl 1-[(1-butan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(1-butan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103108014 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | methyl 1-[(1-butan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate |
| SMILES | CCC(C)n1ccc(Cn2cc(C(=O)OC)nn2)n1 |
| InChI | InChI=1S/C12H17N5O2/c1-4-9(2)17-6-5-10(14-17)7-16-8-11(13-15-16)12(18)19-3/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | LOXJFXANSSVWOT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |