C14H19N5O2 — CID 103107476
methyl 1-[(1-cyclohexylpyrazol-3-yl)methyl]triazole-4-carboxylate (PubChem CID 103107476) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl 1-[(1-cyclohexylpyrazol-3-yl)methyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(1-cyclohexylpyrazol-3-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103107476 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | methyl 1-[(1-cyclohexylpyrazol-3-yl)methyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(Cc2ccn(C3CCCCC3)n2)nn1 |
| InChI | InChI=1S/C14H19N5O2/c1-21-14(20)13-10-18(17-15-13)9-11-7-8-19(16-11)12-5-3-2-4-6-12/h7-8,10,12H,2-6,9H2,1H3 |
| InChIKey | JHCYZRNEKBNCBR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |