C18H21N5O — CID 146121632
[1-[(1-cyclopentylpyrazol-3-yl)methyl]triazol-4-yl]-phenylmethanol (PubChem CID 146121632) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is [1-[(1-cyclopentylpyrazol-3-yl)methyl]triazol-4-yl]-phenylmethanol.
| Compound Name | [1-[(1-cyclopentylpyrazol-3-yl)methyl]triazol-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 146121632 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [1-[(1-cyclopentylpyrazol-3-yl)methyl]triazol-4-yl]-phenylmethanol |
| SMILES | OC(c1ccccc1)c1cn(Cc2ccn(C3CCCC3)n2)nn1 |
| InChI | InChI=1S/C18H21N5O/c24-18(14-6-2-1-3-7-14)17-13-22(21-19-17)12-15-10-11-23(20-15)16-8-4-5-9-16/h1-3,6-7,10-11,13,16,18,24H,4-5,8-9,12H2 |
| InChIKey | NBJDBWZIKXPVAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |