C17H23N3 — CID 64777224
2-(1-cyclopentylpyrazol-3-yl)-N-methyl-1-phenylethanamine (PubChem CID 64777224) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-(1-cyclopentylpyrazol-3-yl)-N-methyl-1-phenylethanamine.
| Compound Name | 2-(1-cyclopentylpyrazol-3-yl)-N-methyl-1-phenylethanamine |
|---|---|
| PubChem CID | 64777224 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-(1-cyclopentylpyrazol-3-yl)-N-methyl-1-phenylethanamine |
| SMILES | CNC(Cc1ccn(C2CCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H23N3/c1-18-17(14-7-3-2-4-8-14)13-15-11-12-20(19-15)16-9-5-6-10-16/h2-4,7-8,11-12,16-18H,5-6,9-10,13H2,1H3 |
| InChIKey | AGHCJDVIWBNIKY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |