C16H25N5 — CID 107975620
2-(1-cyclohexylpyrazol-3-yl)-N-methyl-1-(1-methylimidazol-4-yl)ethanamine (PubChem CID 107975620) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(1-cyclohexylpyrazol-3-yl)-N-methyl-1-(1-methylimidazol-4-yl)ethanamine.
| Compound Name | 2-(1-cyclohexylpyrazol-3-yl)-N-methyl-1-(1-methylimidazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107975620 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 2-(1-cyclohexylpyrazol-3-yl)-N-methyl-1-(1-methylimidazol-4-yl)ethanamine |
| SMILES | CNC(Cc1ccn(C2CCCCC2)n1)c1cn(C)cn1 |
| InChI | InChI=1S/C16H25N5/c1-17-15(16-11-20(2)12-18-16)10-13-8-9-21(19-13)14-6-4-3-5-7-14/h8-9,11-12,14-15,17H,3-7,10H2,1-2H3 |
| InChIKey | AXKTUNFIGKQBOB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |