C12H19BrN6O — CID 66206441
N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 66206441) has the molecular formula C12H19BrN6O and a molecular weight of 343.23 g/mol. Its IUPAC name is N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66206441 |
| Molecular Formula | C12H19BrN6O |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cn(Cc2c(Br)c(C)nn2C)nn1 |
| InChI | InChI=1S/C12H19BrN6O/c1-9-12(13)11(18(2)16-9)8-19-7-10(15-17-19)6-14-4-5-20-3/h7,14H,4-6,8H2,1-3H3 |
| InChIKey | GXUQYMIUZPRWOB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|