C11H20N8O — CID 66204818
2-methoxy-N-[[1-[(1-propyltetrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine (PubChem CID 66204818) has the molecular formula C11H20N8O and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-methoxy-N-[[1-[(1-propyltetrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[1-[(1-propyltetrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66204818 |
| Molecular Formula | C11H20N8O |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-methoxy-N-[[1-[(1-propyltetrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine |
| SMILES | CCCn1nnnc1Cn1cc(CNCCOC)nn1 |
| InChI | InChI=1S/C11H20N8O/c1-3-5-19-11(14-15-17-19)9-18-8-10(13-16-18)7-12-4-6-20-2/h8,12H,3-7,9H2,1-2H3 |
| InChIKey | IOMOEVFSDMCRJZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|