C13H16Cl2N4O — CID 66192493
N-[[1-[(3,4-dichlorophenyl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 66192493) has the molecular formula C13H16Cl2N4O and a molecular weight of 315.20 g/mol. Its IUPAC name is N-[[1-[(3,4-dichlorophenyl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-[(3,4-dichlorophenyl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66192493 |
| Molecular Formula | C13H16Cl2N4O |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-[[1-[(3,4-dichlorophenyl)methyl]triazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cn(Cc2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C13H16Cl2N4O/c1-20-5-4-16-7-11-9-19(18-17-11)8-10-2-3-12(14)13(15)6-10/h2-3,6,9,16H,4-5,7-8H2,1H3 |
| InChIKey | IEBIKOSWTCUHJE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|