C12H19BrN6 — CID 66193876
N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine (PubChem CID 66193876) has the molecular formula C12H19BrN6 and a molecular weight of 327.23 g/mol. Its IUPAC name is N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66193876 |
| Molecular Formula | C12H19BrN6 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn(Cc2c(Br)c(C)nn2CC)nn1 |
| InChI | InChI=1S/C12H19BrN6/c1-4-14-6-10-7-18(17-15-10)8-11-12(13)9(3)16-19(11)5-2/h7,14H,4-6,8H2,1-3H3 |
| InChIKey | JZXXLZFGUUFUBD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |