C11H17BrN6 — CID 116642247
2-[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]ethanamine (PubChem CID 116642247) has the molecular formula C11H17BrN6 and a molecular weight of 313.20 g/mol. Its IUPAC name is 2-[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]ethanamine.
| Compound Name | 2-[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 116642247 |
| Molecular Formula | C11H17BrN6 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]ethanamine |
| SMILES | CCn1nc(C)c(Br)c1Cn1cc(CCN)nn1 |
| InChI | InChI=1S/C11H17BrN6/c1-3-18-10(11(12)8(2)15-18)7-17-6-9(4-5-13)14-16-17/h6H,3-5,7,13H2,1-2H3 |
| InChIKey | ACKNVDLBELDQGM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |