C13H14IN3O2 — CID 167918078
(4-iodophenyl)methyl 1-propyltriazole-4-carboxylate (PubChem CID 167918078) has the molecular formula C13H14IN3O2 and a molecular weight of 371.18 g/mol. Its IUPAC name is (4-iodophenyl)methyl 1-propyltriazole-4-carboxylate.
| Compound Name | (4-iodophenyl)methyl 1-propyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 167918078 |
| Molecular Formula | C13H14IN3O2 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (4-iodophenyl)methyl 1-propyltriazole-4-carboxylate |
| SMILES | CCCn1cc(C(=O)OCc2ccc(I)cc2)nn1 |
| InChI | InChI=1S/C13H14IN3O2/c1-2-7-17-8-12(15-16-17)13(18)19-9-10-3-5-11(14)6-4-10/h3-6,8H,2,7,9H2,1H3 |
| InChIKey | UFPBKNIBQKOMOY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|