C20H22N4O3S — CID 55515823
ethyl 2-[(1-benzyltriazole-4-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 55515823) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is ethyl 2-[(1-benzyltriazole-4-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(1-benzyltriazole-4-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55515823 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl 2-[(1-benzyltriazole-4-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cn(Cc3ccccc3)nn2)sc(C)c1CC |
| InChI | InChI=1S/C20H22N4O3S/c1-4-15-13(3)28-19(17(15)20(26)27-5-2)21-18(25)16-12-24(23-22-16)11-14-9-7-6-8-10-14/h6-10,12H,4-5,11H2,1-3H3,(H,21,25) |
| InChIKey | ZTKGBIRPBWZLDX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |