C18H27NO6SSi — CID 10884166
2-trimethylsilylethyl 3-[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]propanoate (PubChem CID 10884166) has the molecular formula C18H27NO6SSi and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]propanoate.
| Compound Name | 2-trimethylsilylethyl 3-[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]propanoate |
|---|---|
| PubChem CID | 10884166 |
| Molecular Formula | C18H27NO6SSi |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-trimethylsilylethyl 3-[1-(4-methylphenyl)sulfonyloxy-4-oxoazetidin-2-yl]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)ON2C(=O)CC2CCC(=O)OCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO6SSi/c1-14-5-8-16(9-6-14)26(22,23)25-19-15(13-17(19)20)7-10-18(21)24-11-12-27(2,3)4/h5-6,8-9,15H,7,10-13H2,1-4H3 |
| InChIKey | BFEOPMUAVNAVIG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|