C16H27N2O5SSi- — CID 21090421
4-methylbenzenesulfonate;2-trimethylsilylethyl N-(azetidin-3-yl)carbamate (PubChem CID 21090421) has the molecular formula C16H27N2O5SSi- and a molecular weight of 387.55 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;2-trimethylsilylethyl N-(azetidin-3-yl)carbamate.
| Compound Name | 4-methylbenzenesulfonate;2-trimethylsilylethyl N-(azetidin-3-yl)carbamate |
|---|---|
| PubChem CID | 21090421 |
| Molecular Formula | C16H27N2O5SSi- |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-methylbenzenesulfonate;2-trimethylsilylethyl N-(azetidin-3-yl)carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)NC1CNC1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C9H20N2O2Si.C7H8O3S/c1-14(2,3)5-4-13-9(12)11-8-6-10-7-8;1-6-2-4-7(5-3-6)11(8,9)10/h8,10H,4-7H2,1-3H3,(H,11,12);2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | FKJJFEBQDGUVJI-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|