C13H21NO3SSi — CID 171661696
(4-methylphenyl)-oxido-(2-trimethylsilylethoxycarbonylamino)sulfanium (PubChem CID 171661696) has the molecular formula C13H21NO3SSi and a molecular weight of 299.47 g/mol. Its IUPAC name is (4-methylphenyl)-oxido-(2-trimethylsilylethoxycarbonylamino)sulfanium.
| Compound Name | (4-methylphenyl)-oxido-(2-trimethylsilylethoxycarbonylamino)sulfanium |
|---|---|
| PubChem CID | 171661696 |
| Molecular Formula | C13H21NO3SSi |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (4-methylphenyl)-oxido-(2-trimethylsilylethoxycarbonylamino)sulfanium |
| SMILES | Cc1ccc([S+]([O-])NC(=O)OCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C13H21NO3SSi/c1-11-5-7-12(8-6-11)18(16)14-13(15)17-9-10-19(2,3)4/h5-8H,9-10H2,1-4H3,(H,14,15) |
| InChIKey | SOIYCIZKANNGIL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|