About 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate
4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate (PubChem CID 20612433) has the molecular formula C10H18O5Si
and a molecular weight of 246.33 g/mol. Its IUPAC name is 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate.
Molecular Properties
| Compound Name | 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate |
| PubChem CID | 20612433 |
| Molecular Formula | C10H18O5Si |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate |
| SMILES | COC(=O)CC(=O)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C10H18O5Si/c1-14-9(12)7-8(11)10(13)15-5-6-16(2,3)4/h5-7H2,1-4H3 |
| InChIKey | ZZWKKWKCXQPSCP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate?
The IUPAC name of 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate (CID 20612433) is 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate.
What is the SMILES notation for 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate?
The canonical SMILES for 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate is COC(=O)CC(=O)C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate?
The InChIKey is ZZWKKWKCXQPSCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5Si/c1-14-9(12)7-8(11)10(13)15-5-6-16(2,3)4/h5-7H2,1-4H3.
What are the key properties of 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate?
4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate has a molecular weight of 246.33 g/mol, XLogP of 1.00, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-methyl 1-O-(2-trimethylsilylethyl) 2-oxobutanedioate is sourced from PubChem (CID 20612433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).