About 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate
2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate (PubChem CID 21244454) has the molecular formula C9H21NO3Si
and a molecular weight of 219.36 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate |
| PubChem CID | 21244454 |
| Molecular Formula | C9H21NO3Si |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate |
| SMILES | CC(C)(ON)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C9H21NO3Si/c1-9(2,13-10)8(11)12-6-7-14(3,4)5/h6-7,10H2,1-5H3 |
| InChIKey | YNFBRYHZRXGBSX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate?
The IUPAC name of 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate (CID 21244454) is 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate.
What is the SMILES notation for 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate?
The canonical SMILES for 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate is CC(C)(ON)C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate?
The InChIKey is YNFBRYHZRXGBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO3Si/c1-9(2,13-10)8(11)12-6-7-14(3,4)5/h6-7,10H2,1-5H3.
What are the key properties of 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate?
2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate has a molecular weight of 219.36 g/mol, XLogP of 1.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-aminooxy-2-methylpropanoate is sourced from PubChem (CID 21244454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).