C39H84O6Si3 — CID 90770984
2-trimethylsilylethyl 2,2-dimethylbutanoate;3-trimethylsilylpropyl 2,2-dimethylbutanoate;tri(propan-2-yl)silylmethyl 2,2-dimethylbutanoate (PubChem CID 90770984) has the molecular formula C39H84O6Si3 and a molecular weight of 733.35 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2,2-dimethylbutanoate;3-trimethylsilylpropyl 2,2-dimethylbutanoate;tri(propan-2-yl)silylmethyl 2,2-dimethylbutanoate.
| Compound Name | 2-trimethylsilylethyl 2,2-dimethylbutanoate;3-trimethylsilylpropyl 2,2-dimethylbutanoate;tri(propan-2-yl)silylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90770984 |
| Molecular Formula | C39H84O6Si3 |
| Molecular Weight | 733.35 g/mol |
| Exact Mass | 732.56 |
| IUPAC Name | 2-trimethylsilylethyl 2,2-dimethylbutanoate;3-trimethylsilylpropyl 2,2-dimethylbutanoate;tri(propan-2-yl)silylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCC[Si](C)(C)C.CCC(C)(C)C(=O)OCC[Si](C)(C)C.CCC(C)(C)C(=O)OC[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34O2Si.C12H26O2Si.C11H24O2Si/c1-10-16(8,9)15(17)18-11-19(12(2)3,13(4)5)14(6)7;1-7-12(2,3)11(13)14-9-8-10-15(4,5)6;1-7-11(2,3)10(12)13-8-9-14(4,5)6/h12-14H,10-11H2,1-9H3;7-10H2,1-6H3;7-9H2,1-6H3 |
| InChIKey | MKOWOUPWUALQMA-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.35 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|