C19H33N3O4S — CID 13379059
2-(cyclohexylcarbamoylamino)ethyl-trimethylazanium;4-methylbenzenesulfonate (PubChem CID 13379059) has the molecular formula C19H33N3O4S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoylamino)ethyl-trimethylazanium;4-methylbenzenesulfonate.
| Compound Name | 2-(cyclohexylcarbamoylamino)ethyl-trimethylazanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13379059 |
| Molecular Formula | C19H33N3O4S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(cyclohexylcarbamoylamino)ethyl-trimethylazanium;4-methylbenzenesulfonate |
| SMILES | C[N+](C)(C)CCNC(=O)NC1CCCCC1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C12H25N3O.C7H8O3S/c1-15(2,3)10-9-13-12(16)14-11-7-5-4-6-8-11;1-6-2-4-7(5-3-6)11(8,9)10/h11H,4-10H2,1-3H3,(H-,13,14,16);2-5H,1H3,(H,8,9,10) |
| InChIKey | IHFXVNKUGKIKBE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|