C20H31N5O3 — CID 55513953
1-cyclohexyl-3-[4-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-4-oxobutyl]urea (PubChem CID 55513953) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-4-oxobutyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-4-oxobutyl]urea |
|---|---|
| PubChem CID | 55513953 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 1-cyclohexyl-3-[4-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-4-oxobutyl]urea |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CCCNC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H31N5O3/c1-15-9-11-16(12-10-15)22-14-19(27)25-24-18(26)8-5-13-21-20(28)23-17-6-3-2-4-7-17/h9-12,17,22H,2-8,13-14H2,1H3,(H,24,26)(H,25,27)(H2,21,23,28) |
| InChIKey | WUBJYYOZOQDZHZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|