C21H33N3O3 — CID 31031780
N-(5-tert-butyl-2-hydroxyphenyl)-4-(cyclohexylcarbamoylamino)butanamide (PubChem CID 31031780) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-4-(cyclohexylcarbamoylamino)butanamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-4-(cyclohexylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 31031780 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-4-(cyclohexylcarbamoylamino)butanamide |
| SMILES | CC(C)(C)c1ccc(O)c(NC(=O)CCCNC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C21H33N3O3/c1-21(2,3)15-11-12-18(25)17(14-15)24-19(26)10-7-13-22-20(27)23-16-8-5-4-6-9-16/h11-12,14,16,25H,4-10,13H2,1-3H3,(H,24,26)(H2,22,23,27) |
| InChIKey | VTQQPZJYMLJFGY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|