C22H34N4O3 — CID 86955767
2-[6-(cyclohexylcarbamoylamino)hexanoylamino]-N,6-dimethylbenzamide (PubChem CID 86955767) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[6-(cyclohexylcarbamoylamino)hexanoylamino]-N,6-dimethylbenzamide.
| Compound Name | 2-[6-(cyclohexylcarbamoylamino)hexanoylamino]-N,6-dimethylbenzamide |
|---|---|
| PubChem CID | 86955767 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 2-[6-(cyclohexylcarbamoylamino)hexanoylamino]-N,6-dimethylbenzamide |
| SMILES | CNC(=O)c1c(C)cccc1NC(=O)CCCCCNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H34N4O3/c1-16-10-9-13-18(20(16)21(28)23-2)26-19(27)14-7-4-8-15-24-22(29)25-17-11-5-3-6-12-17/h9-10,13,17H,3-8,11-12,14-15H2,1-2H3,(H,23,28)(H,26,27)(H2,24,25,29) |
| InChIKey | GFHKTVVRGDEHEC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|