C20H33ClN4O2 — CID 120568203
N-(5-amino-2-methylphenyl)-6-(cyclohexylcarbamoylamino)hexanamide;hydrochloride (PubChem CID 120568203) has the molecular formula C20H33ClN4O2 and a molecular weight of 396.96 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-6-(cyclohexylcarbamoylamino)hexanamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-6-(cyclohexylcarbamoylamino)hexanamide;hydrochloride |
|---|---|
| PubChem CID | 120568203 |
| Molecular Formula | C20H33ClN4O2 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-6-(cyclohexylcarbamoylamino)hexanamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)CCCCCNC(=O)NC1CCCCC1.Cl |
| InChI | InChI=1S/C20H32N4O2.ClH/c1-15-11-12-16(21)14-18(15)24-19(25)10-6-3-7-13-22-20(26)23-17-8-4-2-5-9-17;/h11-12,14,17H,2-10,13,21H2,1H3,(H,24,25)(H2,22,23,26);1H |
| InChIKey | GVZVYOYGWYQGHM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|