C17H26N4O2 — CID 18146705
4-(cyclohexylcarbamoylamino)-N-(6-methyl-2-pyridinyl)butanamide (PubChem CID 18146705) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-(6-methyl-2-pyridinyl)butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-(6-methyl-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 18146705 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-(6-methyl-2-pyridinyl)butanamide |
| SMILES | Cc1cccc(NC(=O)CCCNC(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C17H26N4O2/c1-13-7-5-10-15(19-13)21-16(22)11-6-12-18-17(23)20-14-8-3-2-4-9-14/h5,7,10,14H,2-4,6,8-9,11-12H2,1H3,(H2,18,20,23)(H,19,21,22) |
| InChIKey | CSPBGJDIVMGJPY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|