C16H24N2O3S — CID 154210091
1-cycloheptyl-3-(3,4-dimethylphenyl)sulfonylurea (PubChem CID 154210091) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-cycloheptyl-3-(3,4-dimethylphenyl)sulfonylurea.
| Compound Name | 1-cycloheptyl-3-(3,4-dimethylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 154210091 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-cycloheptyl-3-(3,4-dimethylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NC2CCCCCC2)cc1C |
| InChI | InChI=1S/C16H24N2O3S/c1-12-9-10-15(11-13(12)2)22(20,21)18-16(19)17-14-7-5-3-4-6-8-14/h9-11,14H,3-8H2,1-2H3,(H2,17,18,19) |
| InChIKey | CBBGZHMGFXXVDK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |