C15H25N3O6S — CID 175674410
ethyl (3R,4S,5R)-5-azido-4-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 175674410) has the molecular formula C15H25N3O6S and a molecular weight of 375.45 g/mol. Its IUPAC name is ethyl (3R,4S,5R)-5-azido-4-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4S,5R)-5-azido-4-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 175674410 |
| Molecular Formula | C15H25N3O6S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl (3R,4S,5R)-5-azido-4-methylsulfonyloxy-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@@H](OS(C)(=O)=O)[C@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C15H25N3O6S/c1-5-11(6-2)23-13-9-10(15(19)22-7-3)8-12(17-18-16)14(13)24-25(4,20)21/h9,11-14H,5-8H2,1-4H3/t12-,13-,14+/m1/s1 |
| InChIKey | WHSMECFQCKEEAL-MCIONIFRSA-N |
| XLogP | 2.48 |
| TPSA | 127.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|