C33H58N6O8 — CID 158553070
ethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate;ethyl (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 158553070) has the molecular formula C33H58N6O8 and a molecular weight of 666.86 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate;ethyl (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate;ethyl (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 158553070 |
| Molecular Formula | C33H58N6O8 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.43 |
| IUPAC Name | ethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate;ethyl (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1.CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N=C(N)N)C1 |
| InChI | InChI=1S/C17H30N4O4.C16H28N2O4/c1-5-12(6-2)25-14-9-11(16(23)24-7-3)8-13(21-17(18)19)15(14)20-10(4)22;1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19/h9,12-15H,5-8H2,1-4H3,(H,20,22)(H4,18,19,21);9,12-15H,5-8,17H2,1-4H3,(H,18,19)/t2*13-,14+,15+/m00/s1 |
| InChIKey | HPYPECVUHWPSQI-OAYFPLQCSA-N |
| XLogP | 1.89 |
| TPSA | 219.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|