C16H26N4O4 — CID 53423532
ethyl 4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 53423532) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is ethyl 4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | ethyl 4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 53423532 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | ethyl 4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(OC(CC)CC)C(NC(C)=O)C(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C16H26N4O4/c1-5-12(6-2)24-14-9-11(16(22)23-7-3)8-13(19-20-17)15(14)18-10(4)21/h9,12-15H,5-8H2,1-4H3,(H,18,21) |
| InChIKey | MPTCBJSPQVJIPZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|