C11H16N4O4 — CID 15283982
methyl (3R,4R,5S)-4-acetamido-5-azido-3-methoxycyclohexene-1-carboxylate (PubChem CID 15283982) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is methyl (3R,4R,5S)-4-acetamido-5-azido-3-methoxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4R,5S)-4-acetamido-5-azido-3-methoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 15283982 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methyl (3R,4R,5S)-4-acetamido-5-azido-3-methoxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](OC)[C@H](NC(C)=O)[C@@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C11H16N4O4/c1-6(16)13-10-8(14-15-12)4-7(11(17)19-3)5-9(10)18-2/h5,8-10H,4H2,1-3H3,(H,13,16)/t8-,9+,10+/m0/s1 |
| InChIKey | IDQQSNPSDNWZDE-IVZWLZJFSA-N |
| XLogP | 0.69 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|