C18H25N3O6 — CID 158128534
methyl (3S,4S,5R)-3-azido-4-hydroxy-5-methylcyclohexene-1-carboxylate;methyl (1R,5R,6S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 158128534) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is methyl (3S,4S,5R)-3-azido-4-hydroxy-5-methylcyclohexene-1-carboxylate;methyl (1R,5R,6S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | methyl (3S,4S,5R)-3-azido-4-hydroxy-5-methylcyclohexene-1-carboxylate;methyl (1R,5R,6S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 158128534 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | methyl (3S,4S,5R)-3-azido-4-hydroxy-5-methylcyclohexene-1-carboxylate;methyl (1R,5R,6S)-5-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](O)[C@H](C)C1.COC(=O)C1=C[C@H]2O[C@H]2[C@H](C)C1 |
| InChI | InChI=1S/C9H13N3O3.C9H12O3/c1-5-3-6(9(14)15-2)4-7(8(5)13)11-12-10;1-5-3-6(9(10)11-2)4-7-8(5)12-7/h4-5,7-8,13H,3H2,1-2H3;4-5,7-8H,3H2,1-2H3/t5-,7+,8+;5-,7-,8+/m11/s1 |
| InChIKey | FSMCVSFUWSLIIL-FRACNNFHSA-N |
| XLogP | 2.06 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|