C9H11N3O2 — CID 59954426
methyl (1S,6S)-5-azidobicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 59954426) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is methyl (1S,6S)-5-azidobicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | methyl (1S,6S)-5-azidobicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 59954426 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | methyl (1S,6S)-5-azidobicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C[C@@H]2C(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C9H11N3O2/c1-14-9(13)6-2-5-3-7(5)8(4-6)11-12-10/h2,5,7-8H,3-4H2,1H3/t5-,7+,8?/m1/s1 |
| InChIKey | CMUPDTGNEANQLW-RARYBDLZSA-N |
| XLogP | 1.80 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|