C12H17N3O3 — CID 20651736
methyl 5-azido-4-methyl-3-prop-2-enoxycyclohexene-1-carboxylate (PubChem CID 20651736) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is methyl 5-azido-4-methyl-3-prop-2-enoxycyclohexene-1-carboxylate.
| Compound Name | methyl 5-azido-4-methyl-3-prop-2-enoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 20651736 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl 5-azido-4-methyl-3-prop-2-enoxycyclohexene-1-carboxylate |
| SMILES | C=CCOC1C=C(C(=O)OC)CC(N=[N+]=[N-])C1C |
| InChI | InChI=1S/C12H17N3O3/c1-4-5-18-11-7-9(12(16)17-3)6-10(8(11)2)14-15-13/h4,7-8,10-11H,1,5-6H2,2-3H3 |
| InChIKey | BSGQKMJIGGRJSB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|