C11H14NO2Tl — CID 148892738
[(1S,5S,6R)-3-methoxycarbonyl-5-prop-2-enyl-7-azabicyclo[4.1.0]hept-2-en-7-yl]thallium (PubChem CID 148892738) has the molecular formula C11H14NO2Tl and a molecular weight of 396.62 g/mol. Its IUPAC name is [(1S,5S,6R)-3-methoxycarbonyl-5-prop-2-enyl-7-azabicyclo[4.1.0]hept-2-en-7-yl]thallium.
| Compound Name | [(1S,5S,6R)-3-methoxycarbonyl-5-prop-2-enyl-7-azabicyclo[4.1.0]hept-2-en-7-yl]thallium |
|---|---|
| PubChem CID | 148892738 |
| Molecular Formula | C11H14NO2Tl |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [(1S,5S,6R)-3-methoxycarbonyl-5-prop-2-enyl-7-azabicyclo[4.1.0]hept-2-en-7-yl]thallium |
| SMILES | C=CC[C@H]1CC(C(=O)OC)=C[C@H]2[C@@H]1N2[Tl] |
| InChI | InChI=1S/C11H14NO2.Tl/c1-3-4-7-5-8(11(13)14-2)6-9-10(7)12-9;/h3,6-7,9-10H,1,4-5H2,2H3;/q-1;+1/t7-,9-,10+;/m0./s1 |
| InChIKey | PFGJARZNSWPBTB-AVZUWDKFSA-N |
| XLogP | 0.82 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|