C10H12NO2Tl — CID 163540019
[(1R,2S,6S)-2-ethenyl-4-methoxycarbonyl-7-azabicyclo[4.1.0]hept-3-en-7-yl]thallium (PubChem CID 163540019) has the molecular formula C10H12NO2Tl and a molecular weight of 382.59 g/mol. Its IUPAC name is [(1R,2S,6S)-2-ethenyl-4-methoxycarbonyl-7-azabicyclo[4.1.0]hept-3-en-7-yl]thallium.
| Compound Name | [(1R,2S,6S)-2-ethenyl-4-methoxycarbonyl-7-azabicyclo[4.1.0]hept-3-en-7-yl]thallium |
|---|---|
| PubChem CID | 163540019 |
| Molecular Formula | C10H12NO2Tl |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [(1R,2S,6S)-2-ethenyl-4-methoxycarbonyl-7-azabicyclo[4.1.0]hept-3-en-7-yl]thallium |
| SMILES | C=C[C@H]1C=C(C(=O)OC)C[C@H]2[C@@H]1N2[Tl] |
| InChI | InChI=1S/C10H12NO2.Tl/c1-3-6-4-7(10(12)13-2)5-8-9(6)11-8;/h3-4,6,8-9H,1,5H2,2H3;/q-1;+1/t6-,8-,9+;/m0./s1 |
| InChIKey | FAHZOLUZDBHTFC-FGWQWHNASA-N |
| XLogP | 0.43 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|